C18H26N2O2 — CID 90635862
3-cyclohexyl-1-(3,4-dihydro-1H-isochromen-3-ylmethyl)-1-methylurea (PubChem CID 90635862) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3,4-dihydro-1H-isochromen-3-ylmethyl)-1-methylurea.
| Compound Name | 3-cyclohexyl-1-(3,4-dihydro-1H-isochromen-3-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 90635862 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-cyclohexyl-1-(3,4-dihydro-1H-isochromen-3-ylmethyl)-1-methylurea |
| SMILES | CN(CC1Cc2ccccc2CO1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H26N2O2/c1-20(18(21)19-16-9-3-2-4-10-16)12-17-11-14-7-5-6-8-15(14)13-22-17/h5-8,16-17H,2-4,9-13H2,1H3,(H,19,21) |
| InChIKey | VYFCHBCRDDNDDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |