C16H16N4O5 — CID 90636925
[3-(3-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 90636925) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is [3-(3-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [3-(3-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90636925 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [3-(3-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1nccnc1OC1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C16H16N4O5/c1-24-14-15(18-8-7-17-14)25-13-6-9-19(10-13)16(21)11-2-4-12(5-3-11)20(22)23/h2-5,7-8,13H,6,9-10H2,1H3 |
| InChIKey | OXKQSEGBXJWVMP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|