C17H11NO — CID 906373
15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one (PubChem CID 906373) has the molecular formula C17H11NO and a molecular weight of 245.28 g/mol. Its IUPAC name is 15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one.
| Compound Name | 15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one |
|---|---|
| PubChem CID | 906373 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 15-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one |
| SMILES | Cc1cc2c3c(cccc3n1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H11NO/c1-10-9-14-11-5-2-3-6-12(11)17(19)13-7-4-8-15(18-10)16(13)14/h2-9H,1H3 |
| InChIKey | PWVPMWHZFKAUMG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |