C14H21ClN4O2 — CID 90637772
4-chloro-1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]butan-1-one (PubChem CID 90637772) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-chloro-1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-chloro-1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 90637772 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-chloro-1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]butan-1-one |
| SMILES | CN(C)c1cncc(OC2CCN(C(=O)CCCCl)C2)n1 |
| InChI | InChI=1S/C14H21ClN4O2/c1-18(2)12-8-16-9-13(17-12)21-11-5-7-19(10-11)14(20)4-3-6-15/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | PSXQGECZRZYSDF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|