C20H24N4O4S — CID 90638724
[3-(6-methylpyridazin-3-yl)oxypyrrolidin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone (PubChem CID 90638724) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is [3-(6-methylpyridazin-3-yl)oxypyrrolidin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone.
| Compound Name | [3-(6-methylpyridazin-3-yl)oxypyrrolidin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 90638724 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [3-(6-methylpyridazin-3-yl)oxypyrrolidin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
| SMILES | Cc1ccc(OC2CCN(C(=O)c3ccc(S(=O)(=O)N4CCCC4)cc3)C2)nn1 |
| InChI | InChI=1S/C20H24N4O4S/c1-15-4-9-19(22-21-15)28-17-10-13-23(14-17)20(25)16-5-7-18(8-6-16)29(26,27)24-11-2-3-12-24/h4-9,17H,2-3,10-14H2,1H3 |
| InChIKey | RDGYJLFIOXEJPT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |