C18H22N4O4 — CID 90639320
N-(4-ethoxyphenyl)-3-(6-methoxypyridazin-3-yl)oxypyrrolidine-1-carboxamide (PubChem CID 90639320) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-(6-methoxypyridazin-3-yl)oxypyrrolidine-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-3-(6-methoxypyridazin-3-yl)oxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 90639320 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-(6-methoxypyridazin-3-yl)oxypyrrolidine-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CCC(Oc3ccc(OC)nn3)C2)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-3-25-14-6-4-13(5-7-14)19-18(23)22-11-10-15(12-22)26-17-9-8-16(24-2)20-21-17/h4-9,15H,3,10-12H2,1-2H3,(H,19,23) |
| InChIKey | FLSWPMJRPVTEBQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |