C15H16ClN3O2 — CID 90640483
N-(5-chloro-2-hydroxyphenyl)-2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide (PubChem CID 90640483) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90640483 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-methyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1nc2c([nH]1)CC(C(=O)Nc1cc(Cl)ccc1O)CC2 |
| InChI | InChI=1S/C15H16ClN3O2/c1-8-17-11-4-2-9(6-12(11)18-8)15(21)19-13-7-10(16)3-5-14(13)20/h3,5,7,9,20H,2,4,6H2,1H3,(H,17,18)(H,19,21) |
| InChIKey | OYCFBLXDRQAEEZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|