C20H15NO4 — CID 906418
ethyl 14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carboxylate (PubChem CID 906418) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is ethyl 14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carboxylate.
| Compound Name | ethyl 14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carboxylate |
|---|---|
| PubChem CID | 906418 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carboxylate |
| SMILES | CCOC(=O)c1c2c3c(cccc3n(C)c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H15NO4/c1-3-25-20(24)17-16-11-7-4-5-8-12(11)18(22)13-9-6-10-14(15(13)16)21(2)19(17)23/h4-10H,3H2,1-2H3 |
| InChIKey | WXSNKVBZNWFPKC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |