C22H26N6O2 — CID 90642399
N-(3-phenylpropyl)-3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carboxamide (PubChem CID 90642399) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-(3-phenylpropyl)-3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)-3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90642399 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-(3-phenylpropyl)-3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)N1CCCC(Cc2nc(-c3cnccn3)no2)C1 |
| InChI | InChI=1S/C22H26N6O2/c29-22(25-10-4-8-17-6-2-1-3-7-17)28-13-5-9-18(16-28)14-20-26-21(27-30-20)19-15-23-11-12-24-19/h1-3,6-7,11-12,15,18H,4-5,8-10,13-14,16H2,(H,25,29) |
| InChIKey | CFCILPWVMJDYBA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|