About 4-ethenoxyquinazoline
4-ethenoxyquinazoline (PubChem CID 90642939) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 4-ethenoxyquinazoline.
Molecular Properties
| Compound Name | 4-ethenoxyquinazoline |
| PubChem CID | 90642939 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 4-ethenoxyquinazoline |
| SMILES | C=COc1ncnc2ccccc12 |
| InChI | InChI=1S/C10H8N2O/c1-2-13-10-8-5-3-4-6-9(8)11-7-12-10/h2-7H,1H2 |
| InChIKey | RDCBYRKKRTZYHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxyquinazoline?
The IUPAC name of 4-ethenoxyquinazoline (CID 90642939) is 4-ethenoxyquinazoline.
What is the SMILES notation for 4-ethenoxyquinazoline?
The canonical SMILES for 4-ethenoxyquinazoline is C=COc1ncnc2ccccc12.
What is the InChIKey of 4-ethenoxyquinazoline?
The InChIKey is RDCBYRKKRTZYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-2-13-10-8-5-3-4-6-9(8)11-7-12-10/h2-7H,1H2.
What are the key properties of 4-ethenoxyquinazoline?
4-ethenoxyquinazoline has a molecular weight of 172.19 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxyquinazoline is sourced from PubChem (CID 90642939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).