About 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide
2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 90643545) has the molecular formula C14H9F2N5OS
and a molecular weight of 333.32 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 90643545 |
| Molecular Formula | C14H9F2N5OS |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1sc(-c2ccnc(N)n2)nc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C14H9F2N5OS/c15-6-1-2-8(16)7(5-6)10-11(12(17)22)23-13(21-10)9-3-4-19-14(18)20-9/h1-5H,(H2,17,22)(H2,18,19,20) |
| InChIKey | DJULSRMGLSGPAV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide (CID 90643545) is 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide is NC(=O)c1sc(-c2ccnc(N)n2)nc1-c1cc(F)ccc1F.
What is the InChIKey of 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide?
The InChIKey is DJULSRMGLSGPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2N5OS/c15-6-1-2-8(16)7(5-6)10-11(12(17)22)23-13(21-10)9-3-4-19-14(18)20-9/h1-5H,(H2,17,22)(H2,18,19,20).
What are the key properties of 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide?
2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide has a molecular weight of 333.32 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminopyrimidin-4-yl)-4-(2,5-difluorophenyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 90643545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).