About (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride
(4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride (PubChem CID 90643562) has the molecular formula C17H19Cl2N3O3
and a molecular weight of 384.26 g/mol. Its IUPAC name is (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride |
| PubChem CID | 90643562 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(Oc1ccc(Cl)cc1)N1CCNCC1COc1cccnc1 |
| InChI | InChI=1S/C17H18ClN3O3.ClH/c18-13-3-5-15(6-4-13)24-17(22)21-9-8-20-10-14(21)12-23-16-2-1-7-19-11-16;/h1-7,11,14,20H,8-10,12H2;1H |
| InChIKey | LCDKIFARRBONDA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride?
The IUPAC name of (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride (CID 90643562) is (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride?
The canonical SMILES for (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride is Cl.O=C(Oc1ccc(Cl)cc1)N1CCNCC1COc1cccnc1.
What is the InChIKey of (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride?
The InChIKey is LCDKIFARRBONDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O3.ClH/c18-13-3-5-15(6-4-13)24-17(22)21-9-8-20-10-14(21)12-23-16-2-1-7-19-11-16;/h1-7,11,14,20H,8-10,12H2;1H.
What are the key properties of (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride?
(4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride has a molecular weight of 384.26 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-(pyridin-3-yloxymethyl)piperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 90643562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).