C26H33N5O4 — CID 90643610
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 90643610) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 90643610 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | COc1cccc(Cn2cc(C(=O)NCCCCN3CCc4cc(OC)c(OC)cc4C3)nn2)c1 |
| InChI | InChI=1S/C26H33N5O4/c1-33-22-8-6-7-19(13-22)16-31-18-23(28-29-31)26(32)27-10-4-5-11-30-12-9-20-14-24(34-2)25(35-3)15-21(20)17-30/h6-8,13-15,18H,4-5,9-12,16-17H2,1-3H3,(H,27,32) |
| InChIKey | WSZZSUDEANZSAK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|