C25H31N5O3 — CID 90643611
1-benzyl-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]triazole-4-carboxamide (PubChem CID 90643611) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-benzyl-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 90643611 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-benzyl-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]triazole-4-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNC(=O)c1cn(Cc3ccccc3)nn1)CC2 |
| InChI | InChI=1S/C25H31N5O3/c1-32-23-14-20-10-13-29(17-21(20)15-24(23)33-2)12-7-6-11-26-25(31)22-18-30(28-27-22)16-19-8-4-3-5-9-19/h3-5,8-9,14-15,18H,6-7,10-13,16-17H2,1-2H3,(H,26,31) |
| InChIKey | YYYKHLUDGDSGLB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|