About 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole
2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole (PubChem CID 90643682) has the molecular formula C18H16N4OS
and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole |
| PubChem CID | 90643682 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole |
| SMILES | Cc1ccc(-n2cc(CSc3nc4ccccc4o3)nn2)cc1C |
| InChI | InChI=1S/C18H16N4OS/c1-12-7-8-15(9-13(12)2)22-10-14(20-21-22)11-24-18-19-16-5-3-4-6-17(16)23-18/h3-10H,11H2,1-2H3 |
| InChIKey | DPOCGLVTVQYWBQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole?
The IUPAC name of 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole (CID 90643682) is 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole?
The canonical SMILES for 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole is Cc1ccc(-n2cc(CSc3nc4ccccc4o3)nn2)cc1C.
What is the InChIKey of 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole?
The InChIKey is DPOCGLVTVQYWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4OS/c1-12-7-8-15(9-13(12)2)22-10-14(20-21-22)11-24-18-19-16-5-3-4-6-17(16)23-18/h3-10H,11H2,1-2H3.
What are the key properties of 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole?
2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole has a molecular weight of 336.42 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylsulfanyl]-1,3-benzoxazole is sourced from PubChem (CID 90643682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).