C22H26N2O6 — CID 90643793
N-[3-hydroxy-4-(piperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 90643793) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[3-hydroxy-4-(piperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-hydroxy-4-(piperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 90643793 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[3-hydroxy-4-(piperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)N3CCCCC3)c(O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O6/c1-28-18-11-14(12-19(29-2)20(18)30-3)21(26)23-15-7-8-16(17(25)13-15)22(27)24-9-5-4-6-10-24/h7-8,11-13,25H,4-6,9-10H2,1-3H3,(H,23,26) |
| InChIKey | DGFZGQCRQDAHHU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |