C24H30O5 — CID 90643890
2-[4-[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]butoxy]benzoic acid (PubChem CID 90643890) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[4-[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]butoxy]benzoic acid.
| Compound Name | 2-[4-[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]butoxy]benzoic acid |
|---|---|
| PubChem CID | 90643890 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[4-[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]butoxy]benzoic acid |
| SMILES | Cc1c(OCCCCOc2ccccc2C(=O)O)ccc(C(=O)CC(C)C)c1C |
| InChI | InChI=1S/C24H30O5/c1-16(2)15-21(25)19-11-12-22(18(4)17(19)3)28-13-7-8-14-29-23-10-6-5-9-20(23)24(26)27/h5-6,9-12,16H,7-8,13-15H2,1-4H3,(H,26,27) |
| InChIKey | OPZYRVOATYJQKL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|