C24H28Cl2N4O3 — CID 90644226
ethyl 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carboxylate (PubChem CID 90644226) has the molecular formula C24H28Cl2N4O3 and a molecular weight of 491.42 g/mol. Its IUPAC name is ethyl 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carboxylate.
| Compound Name | ethyl 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90644226 |
| Molecular Formula | C24H28Cl2N4O3 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | ethyl 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccn2n1 |
| InChI | InChI=1S/C24H28Cl2N4O3/c1-2-32-24(31)21-17-18-16-19(8-10-30(18)27-21)33-15-4-3-9-28-11-13-29(14-12-28)22-7-5-6-20(25)23(22)26/h5-8,10,16-17H,2-4,9,11-15H2,1H3 |
| InChIKey | HXHZPLKJASKRCI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|