C27H28N2O2 — CID 90644257
(1S,14R)-23-[(1-hydroxycyclopropyl)methyl]-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol (PubChem CID 90644257) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (1S,14R)-23-[(1-hydroxycyclopropyl)methyl]-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol.
| Compound Name | (1S,14R)-23-[(1-hydroxycyclopropyl)methyl]-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol |
|---|---|
| PubChem CID | 90644257 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (1S,14R)-23-[(1-hydroxycyclopropyl)methyl]-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol |
| SMILES | Oc1ccc2c(c1)[C@]13CCN(CC4(O)CC4)C[C@@]1(C2)Cc1cc2ccccc2nc1C3 |
| InChI | InChI=1S/C27H28N2O2/c30-21-6-5-19-13-25-14-20-11-18-3-1-2-4-23(18)28-24(20)15-27(25,22(19)12-21)9-10-29(16-25)17-26(31)7-8-26/h1-6,11-12,30-31H,7-10,13-17H2/t25-,27-/m1/s1 |
| InChIKey | KEMHLKRQXZCNPA-XNMGPUDCSA-N |
| XLogP | 3.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |