C30H28N2O — CID 90644258
(1S,14R)-23-benzyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol (PubChem CID 90644258) has the molecular formula C30H28N2O and a molecular weight of 432.57 g/mol. Its IUPAC name is (1S,14R)-23-benzyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol.
| Compound Name | (1S,14R)-23-benzyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol |
|---|---|
| PubChem CID | 90644258 |
| Molecular Formula | C30H28N2O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (1S,14R)-23-benzyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol |
| SMILES | Oc1ccc2c(c1)[C@]13CCN(Cc4ccccc4)C[C@@]1(C2)Cc1cc2ccccc2nc1C3 |
| InChI | InChI=1S/C30H28N2O/c33-25-11-10-23-16-29-17-24-14-22-8-4-5-9-27(22)31-28(24)18-30(29,26(23)15-25)12-13-32(20-29)19-21-6-2-1-3-7-21/h1-11,14-15,33H,12-13,16-20H2/t29-,30-/m1/s1 |
| InChIKey | NKULORCVXYNKSU-LOYHVIPDSA-N |
| XLogP | 5.43 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |