C24H24N2O — CID 90644259
(1S,14R)-23-methyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol (PubChem CID 90644259) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (1S,14R)-23-methyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol.
| Compound Name | (1S,14R)-23-methyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol |
|---|---|
| PubChem CID | 90644259 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (1S,14R)-23-methyl-11,23-diazahexacyclo[12.7.4.01,14.03,12.05,10.015,20]pentacosa-3,5,7,9,11,15(20),16,18-octaen-17-ol |
| SMILES | CN1CC[C@]23Cc4nc5ccccc5cc4C[C@]2(Cc2ccc(O)cc23)C1 |
| InChI | InChI=1S/C24H24N2O/c1-26-9-8-24-14-22-18(10-16-4-2-3-5-21(16)25-22)13-23(24,15-26)12-17-6-7-19(27)11-20(17)24/h2-7,10-11,27H,8-9,12-15H2,1H3/t23-,24-/m1/s1 |
| InChIKey | NJSFZRCPGDKHSE-DNQXCXABSA-N |
| XLogP | 3.86 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |