About 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid
3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid (PubChem CID 90644289) has the molecular formula C21H21NO3S
and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid |
| PubChem CID | 90644289 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid |
| SMILES | Cc1cccc(C)c1-c1cccc(COc2ncc(CCC(=O)O)s2)c1 |
| InChI | InChI=1S/C21H21NO3S/c1-14-5-3-6-15(2)20(14)17-8-4-7-16(11-17)13-25-21-22-12-18(26-21)9-10-19(23)24/h3-8,11-12H,9-10,13H2,1-2H3,(H,23,24) |
| InChIKey | UAJDBHHVDCSZCC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid?
The IUPAC name of 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid (CID 90644289) is 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid is Cc1cccc(C)c1-c1cccc(COc2ncc(CCC(=O)O)s2)c1.
What is the InChIKey of 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid?
The InChIKey is UAJDBHHVDCSZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3S/c1-14-5-3-6-15(2)20(14)17-8-4-7-16(11-17)13-25-21-22-12-18(26-21)9-10-19(23)24/h3-8,11-12H,9-10,13H2,1-2H3,(H,23,24).
What are the key properties of 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid?
3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid has a molecular weight of 367.47 g/mol, XLogP of 5.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[3-(2,6-dimethylphenyl)phenyl]methoxy]-1,3-thiazol-5-yl]propanoic acid is sourced from PubChem (CID 90644289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).