About 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one
3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one (PubChem CID 90644315) has the molecular formula C23H21N5O2
and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 90644315 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one |
| SMILES | COc1cccc2c1nc(CCn1c(=O)n(C)c3cccnc31)n2-c1ccccc1 |
| InChI | InChI=1S/C23H21N5O2/c1-26-18-11-7-14-24-22(18)27(23(26)29)15-13-20-25-21-17(10-6-12-19(21)30-2)28(20)16-8-4-3-5-9-16/h3-12,14H,13,15H2,1-2H3 |
| InChIKey | NJWBURLDPPBZRK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one (CID 90644315) is 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one is COc1cccc2c1nc(CCn1c(=O)n(C)c3cccnc31)n2-c1ccccc1.
What is the InChIKey of 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one?
The InChIKey is NJWBURLDPPBZRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N5O2/c1-26-18-11-7-14-24-22(18)27(23(26)29)15-13-20-25-21-17(10-6-12-19(21)30-2)28(20)16-8-4-3-5-9-16/h3-12,14H,13,15H2,1-2H3.
What are the key properties of 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one?
3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one has a molecular weight of 399.45 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-methoxy-1-phenylbenzimidazol-2-yl)ethyl]-1-methylimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 90644315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).