C24H30N4O2 — CID 90644478
3-piperidin-1-yl-7-(3-piperidin-1-ylpropyl)-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione (PubChem CID 90644478) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-piperidin-1-yl-7-(3-piperidin-1-ylpropyl)-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione.
| Compound Name | 3-piperidin-1-yl-7-(3-piperidin-1-ylpropyl)-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione |
|---|---|
| PubChem CID | 90644478 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3-piperidin-1-yl-7-(3-piperidin-1-ylpropyl)-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione |
| SMILES | O=C1c2cccc3nc(N4CCCCC4)cc(c23)C(=O)N1CCCN1CCCCC1 |
| InChI | InChI=1S/C24H30N4O2/c29-23-18-9-7-10-20-22(18)19(17-21(25-20)27-14-5-2-6-15-27)24(30)28(23)16-8-13-26-11-3-1-4-12-26/h7,9-10,17H,1-6,8,11-16H2 |
| InChIKey | LPGSOWDVNVOQRL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|