C14H9Cl2N3O3S — CID 90644499
2,4-dichloro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide (PubChem CID 90644499) has the molecular formula C14H9Cl2N3O3S and a molecular weight of 370.22 g/mol. Its IUPAC name is 2,4-dichloro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 90644499 |
| Molecular Formula | C14H9Cl2N3O3S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 2,4-dichloro-5-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nnc(-c3ccccc3)o2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N3O3S/c15-10-7-11(16)12(23(17,20)21)6-9(10)14-19-18-13(22-14)8-4-2-1-3-5-8/h1-7H,(H2,17,20,21) |
| InChIKey | IBQJNNPDEPQPIB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |