C18H19F3N2OS2 — CID 90644587
N'-[3-(cyclopentylsulfanylmethyl)-4-(trifluoromethoxy)phenyl]thiophene-2-carboximidamide (PubChem CID 90644587) has the molecular formula C18H19F3N2OS2 and a molecular weight of 400.49 g/mol. Its IUPAC name is N'-[3-(cyclopentylsulfanylmethyl)-4-(trifluoromethoxy)phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-(cyclopentylsulfanylmethyl)-4-(trifluoromethoxy)phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 90644587 |
| Molecular Formula | C18H19F3N2OS2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N'-[3-(cyclopentylsulfanylmethyl)-4-(trifluoromethoxy)phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(OC(F)(F)F)c(CSC2CCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C18H19F3N2OS2/c19-18(20,21)24-15-8-7-13(23-17(22)16-6-3-9-25-16)10-12(15)11-26-14-4-1-2-5-14/h3,6-10,14H,1-2,4-5,11H2,(H2,22,23) |
| InChIKey | LRKLBIWVBTXVDV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|