C30H40N2O4 — CID 90644593
2-[4-[4-[4-(heptylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid (PubChem CID 90644593) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[4-[4-[4-(heptylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[4-(heptylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 90644593 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 2-[4-[4-[4-(heptylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid |
| SMILES | CCCCCCCNC(=O)N1CCOc2cc(-c3ccc(C4CCC(CC(=O)O)CC4)cc3)ccc21 |
| InChI | InChI=1S/C30H40N2O4/c1-2-3-4-5-6-17-31-30(35)32-18-19-36-28-21-26(15-16-27(28)32)25-13-11-24(12-14-25)23-9-7-22(8-10-23)20-29(33)34/h11-16,21-23H,2-10,17-20H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | NGNUMTIXMPRBAL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|