About 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide
6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide (PubChem CID 90644670) has the molecular formula C24H17N3O2
and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide.
Molecular Properties
| Compound Name | 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide |
| PubChem CID | 90644670 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide |
| SMILES | Nc1nccc2occ(-c3ccc4c(C(=O)Nc5ccccc5)cccc4c3)c12 |
| InChI | InChI=1S/C24H17N3O2/c25-23-22-20(14-29-21(22)11-12-26-23)16-9-10-18-15(13-16)5-4-8-19(18)24(28)27-17-6-2-1-3-7-17/h1-14H,(H2,25,26)(H,27,28) |
| InChIKey | RZZXCPQJUTYHOX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide?
The IUPAC name of 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide (CID 90644670) is 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide.
What is the SMILES notation for 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide?
The canonical SMILES for 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide is Nc1nccc2occ(-c3ccc4c(C(=O)Nc5ccccc5)cccc4c3)c12.
What is the InChIKey of 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide?
The InChIKey is RZZXCPQJUTYHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3O2/c25-23-22-20(14-29-21(22)11-12-26-23)16-9-10-18-15(13-16)5-4-8-19(18)24(28)27-17-6-2-1-3-7-17/h1-14H,(H2,25,26)(H,27,28).
What are the key properties of 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide?
6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide has a molecular weight of 379.42 g/mol, XLogP of 5.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-aminofuro[3,2-c]pyridin-3-yl)-N-phenylnaphthalene-1-carboxamide is sourced from PubChem (CID 90644670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).