C25H20F2N4O5 — CID 90644691
methyl (2S)-2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-2-oxo-1,8-naphthyridin-4-yl]amino]-2-phenylacetate (PubChem CID 90644691) has the molecular formula C25H20F2N4O5 and a molecular weight of 494.45 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-2-oxo-1,8-naphthyridin-4-yl]amino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-2-oxo-1,8-naphthyridin-4-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 90644691 |
| Molecular Formula | C25H20F2N4O5 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | methyl (2S)-2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-2-oxo-1,8-naphthyridin-4-yl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](Nc1c(C(=O)NCc2ccc(F)cc2F)c(=O)n(O)c2ncccc12)c1ccccc1 |
| InChI | InChI=1S/C25H20F2N4O5/c1-36-25(34)20(14-6-3-2-4-7-14)30-21-17-8-5-11-28-22(17)31(35)24(33)19(21)23(32)29-13-15-9-10-16(26)12-18(15)27/h2-12,20,30,35H,13H2,1H3,(H,29,32)/t20-/m0/s1 |
| InChIKey | CRXZLZPFZKAGOW-FQEVSTJZSA-N |
| XLogP | 3.17 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|