About 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide
5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide (PubChem CID 90644696) has the molecular formula C13H17BrN2OS
and a molecular weight of 329.26 g/mol. Its IUPAC name is 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide |
| PubChem CID | 90644696 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide |
| SMILES | CN1[C@@H]2CC[C@H]1CC(NC(=O)c1ccc(Br)s1)C2 |
| InChI | InChI=1S/C13H17BrN2OS/c1-16-9-2-3-10(16)7-8(6-9)15-13(17)11-4-5-12(14)18-11/h4-5,8-10H,2-3,6-7H2,1H3,(H,15,17)/t8?,9-,10+ |
| InChIKey | RZVQFTJKMDBETD-PBINXNQUSA-N |
| XLogP | 2.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide?
The IUPAC name of 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide (CID 90644696) is 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide.
What is the SMILES notation for 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide?
The canonical SMILES for 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide is CN1[C@@H]2CC[C@H]1CC(NC(=O)c1ccc(Br)s1)C2.
What is the InChIKey of 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide?
The InChIKey is RZVQFTJKMDBETD-PBINXNQUSA-N. The full InChI is InChI=1S/C13H17BrN2OS/c1-16-9-2-3-10(16)7-8(6-9)15-13(17)11-4-5-12(14)18-11/h4-5,8-10H,2-3,6-7H2,1H3,(H,15,17)/t8?,9-,10+.
What are the key properties of 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide?
5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide has a molecular weight of 329.26 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]thiophene-2-carboxamide is sourced from PubChem (CID 90644696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).