C26H20F3N5O2 — CID 90644800
N-(2-anilinopyrimidin-5-yl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 90644800) has the molecular formula C26H20F3N5O2 and a molecular weight of 491.47 g/mol. Its IUPAC name is N-(2-anilinopyrimidin-5-yl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | N-(2-anilinopyrimidin-5-yl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 90644800 |
| Molecular Formula | C26H20F3N5O2 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-(2-anilinopyrimidin-5-yl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1C(=O)Nc1cnc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C26H20F3N5O2/c1-16-10-11-20(32-23(35)17-6-5-7-18(12-17)26(27,28)29)13-22(16)24(36)33-21-14-30-25(31-15-21)34-19-8-3-2-4-9-19/h2-15H,1H3,(H,32,35)(H,33,36)(H,30,31,34) |
| InChIKey | ZFVFROXJZKNYAE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |