C26H38O6 — CID 90644859
(2E,4E)-5-[(1R,2R,4R,5S,5aS,7aS,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5,11b-trihydroxy-5,6,9-trimethyl-1,2,4,5a,7a,8,11,11a-octahydrobenzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid (PubChem CID 90644859) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (2E,4E)-5-[(1R,2R,4R,5S,5aS,7aS,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5,11b-trihydroxy-5,6,9-trimethyl-1,2,4,5a,7a,8,11,11a-octahydrobenzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1R,2R,4R,5S,5aS,7aS,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5,11b-trihydroxy-5,6,9-trimethyl-1,2,4,5a,7a,8,11,11a-octahydrobenzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90644859 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2E,4E)-5-[(1R,2R,4R,5S,5aS,7aS,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5,11b-trihydroxy-5,6,9-trimethyl-1,2,4,5a,7a,8,11,11a-octahydrobenzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid |
| SMILES | CC[C@@H](C)[C@H]1O[C@H](/C=C/C=C/C(=O)O)[C@@H](O)[C@@]2(O)[C@@H]3CC=C(C)C[C@H]3C=C(C)[C@H]2[C@]1(C)O |
| InChI | InChI=1S/C26H38O6/c1-6-16(3)24-25(5,30)22-17(4)14-18-13-15(2)11-12-19(18)26(22,31)23(29)20(32-24)9-7-8-10-21(27)28/h7-11,14,16,18-20,22-24,29-31H,6,12-13H2,1-5H3,(H,27,28)/b9-7+,10-8+/t16-,18+,19-,20-,22+,23-,24-,25+,26-/m1/s1 |
| InChIKey | WQAFDIKVNMLDOJ-VHAQSBPASA-N |
| XLogP | 3.39 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|