C26H36O5 — CID 90644861
(2E,4E)-5-[(1S,2R,4R,5aR,7aR,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5a-dihydroxy-6,9-dimethyl-5-methylidene-2,7a,8,11,11a,11b-hexahydro-1H-benzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid (PubChem CID 90644861) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is (2E,4E)-5-[(1S,2R,4R,5aR,7aR,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5a-dihydroxy-6,9-dimethyl-5-methylidene-2,7a,8,11,11a,11b-hexahydro-1H-benzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1S,2R,4R,5aR,7aR,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5a-dihydroxy-6,9-dimethyl-5-methylidene-2,7a,8,11,11a,11b-hexahydro-1H-benzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90644861 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (2E,4E)-5-[(1S,2R,4R,5aR,7aR,11aR,11bR)-4-[(2R)-butan-2-yl]-1,5a-dihydroxy-6,9-dimethyl-5-methylidene-2,7a,8,11,11a,11b-hexahydro-1H-benzo[i][3]benzoxepin-2-yl]penta-2,4-dienoic acid |
| SMILES | C=C1[C@@H]([C@H](C)CC)O[C@H](/C=C/C=C/C(=O)O)[C@@H](O)[C@H]2[C@@H]3CC=C(C)C[C@H]3C=C(C)[C@@]12O |
| InChI | InChI=1S/C26H36O5/c1-6-16(3)25-18(5)26(30)17(4)14-19-13-15(2)11-12-20(19)23(26)24(29)21(31-25)9-7-8-10-22(27)28/h7-11,14,16,19-21,23-25,29-30H,5-6,12-13H2,1-4H3,(H,27,28)/b9-7+,10-8+/t16-,19+,20-,21-,23-,24-,25-,26-/m1/s1 |
| InChIKey | RNNQLHOUBURQQV-LJTYFLQPSA-N |
| XLogP | 4.19 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|