About ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate
ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate (PubChem CID 90644882) has the molecular formula C31H26N2O2
and a molecular weight of 458.56 g/mol. Its IUPAC name is ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate |
| PubChem CID | 90644882 |
| Molecular Formula | C31H26N2O2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2c(C)[nH]c(-c3ccccc3)c2-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C31H26N2O2/c1-3-35-31(34)25-19-20-26(33-29(25)23-15-9-5-10-16-23)27-21(2)32-30(24-17-11-6-12-18-24)28(27)22-13-7-4-8-14-22/h4-20,32H,3H2,1-2H3 |
| InChIKey | VUSSFVVQNMDDEU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate?
The IUPAC name of ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate (CID 90644882) is ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate?
The canonical SMILES for ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate is CCOC(=O)c1ccc(-c2c(C)[nH]c(-c3ccccc3)c2-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate?
The InChIKey is VUSSFVVQNMDDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26N2O2/c1-3-35-31(34)25-19-20-26(33-29(25)23-15-9-5-10-16-23)27-21(2)32-30(24-17-11-6-12-18-24)28(27)22-13-7-4-8-14-22/h4-20,32H,3H2,1-2H3.
What are the key properties of ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate?
ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate has a molecular weight of 458.56 g/mol, XLogP of 7.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-phenylpyridine-3-carboxylate is sourced from PubChem (CID 90644882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).