About 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile
6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 90644883) has the molecular formula C23H17N3O
and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile |
| PubChem CID | 90644883 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1ccc(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C23H17N3O/c1-15-20(19-13-12-18(14-24)23(27)26-19)21(16-8-4-2-5-9-16)22(25-15)17-10-6-3-7-11-17/h2-13,25H,1H3,(H,26,27) |
| InChIKey | XNNGIWMVYSKXIW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile?
The IUPAC name of 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile (CID 90644883) is 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile.
What is the SMILES notation for 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile?
The canonical SMILES for 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile is Cc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1ccc(C#N)c(=O)[nH]1.
What is the InChIKey of 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile?
The InChIKey is XNNGIWMVYSKXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O/c1-15-20(19-13-12-18(14-24)23(27)26-19)21(16-8-4-2-5-9-16)22(25-15)17-10-6-3-7-11-17/h2-13,25H,1H3,(H,26,27).
What are the key properties of 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile?
6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile has a molecular weight of 351.41 g/mol, XLogP of 4.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxo-1H-pyridine-3-carbonitrile is sourced from PubChem (CID 90644883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).