About 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride
4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride (PubChem CID 90644907) has the molecular formula C11H18ClN
and a molecular weight of 199.72 g/mol. Its IUPAC name is 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride.
Molecular Properties
| Compound Name | 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride |
| PubChem CID | 90644907 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride |
| SMILES | C1CC2C3CNCC3C1C1CC21.Cl |
| InChI | InChI=1S/C11H17N.ClH/c1-2-7-9-3-8(9)6(1)10-4-12-5-11(7)10;/h6-12H,1-5H2;1H |
| InChIKey | QARZFXMGBDLSAF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride?
The IUPAC name of 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride (CID 90644907) is 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride.
What is the SMILES notation for 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride?
The canonical SMILES for 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride is C1CC2C3CNCC3C1C1CC21.Cl.
What is the InChIKey of 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride?
The InChIKey is QARZFXMGBDLSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.ClH/c1-2-7-9-3-8(9)6(1)10-4-12-5-11(7)10;/h6-12H,1-5H2;1H.
What are the key properties of 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride?
4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride has a molecular weight of 199.72 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatetracyclo[5.3.2.02,6.08,10]dodecane;hydrochloride is sourced from PubChem (CID 90644907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).