C29H27N5O5S — CID 90644938
1-N'-[4-[2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 90644938) has the molecular formula C29H27N5O5S and a molecular weight of 557.63 g/mol. Its IUPAC name is 1-N'-[4-[2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90644938 |
| Molecular Formula | C29H27N5O5S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1-N'-[4-[2-[3-(methylsulfonylmethyl)anilino]pyrimidin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | CS(=O)(=O)Cc1cccc(Nc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccccc5)CC4)cc3)n2)c1 |
| InChI | InChI=1S/C29H27N5O5S/c1-40(37,38)19-20-6-5-9-23(18-20)33-28-30-17-14-25(34-28)39-24-12-10-22(11-13-24)32-27(36)29(15-16-29)26(35)31-21-7-3-2-4-8-21/h2-14,17-18H,15-16,19H2,1H3,(H,31,35)(H,32,36)(H,30,33,34) |
| InChIKey | WLMNKPZFGDGAIG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|