C22H22F2N2O2 — CID 90644975
[(1R,2S)-2-(1H-indol-3-ylmethylamino)cyclohexyl] 3,4-difluorobenzoate (PubChem CID 90644975) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is [(1R,2S)-2-(1H-indol-3-ylmethylamino)cyclohexyl] 3,4-difluorobenzoate.
| Compound Name | [(1R,2S)-2-(1H-indol-3-ylmethylamino)cyclohexyl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 90644975 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(1R,2S)-2-(1H-indol-3-ylmethylamino)cyclohexyl] 3,4-difluorobenzoate |
| SMILES | O=C(O[C@@H]1CCCC[C@@H]1NCc1c[nH]c2ccccc12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H22F2N2O2/c23-17-10-9-14(11-18(17)24)22(27)28-21-8-4-3-7-20(21)26-13-15-12-25-19-6-2-1-5-16(15)19/h1-2,5-6,9-12,20-21,25-26H,3-4,7-8,13H2/t20-,21+/m0/s1 |
| InChIKey | REZDWHZHDSVMTO-LEWJYISDSA-N |
| XLogP | 4.70 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |