C24H32FN3O — CID 90644987
N-[(1R,2S)-2-[[4-(diethylamino)phenyl]methylamino]cyclohexyl]-4-fluorobenzamide (PubChem CID 90644987) has the molecular formula C24H32FN3O and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[4-(diethylamino)phenyl]methylamino]cyclohexyl]-4-fluorobenzamide.
| Compound Name | N-[(1R,2S)-2-[[4-(diethylamino)phenyl]methylamino]cyclohexyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 90644987 |
| Molecular Formula | C24H32FN3O |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[(1R,2S)-2-[[4-(diethylamino)phenyl]methylamino]cyclohexyl]-4-fluorobenzamide |
| SMILES | CCN(CC)c1ccc(CN[C@H]2CCCC[C@H]2NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H32FN3O/c1-3-28(4-2)21-15-9-18(10-16-21)17-26-22-7-5-6-8-23(22)27-24(29)19-11-13-20(25)14-12-19/h9-16,22-23,26H,3-8,17H2,1-2H3,(H,27,29)/t22-,23+/m0/s1 |
| InChIKey | HSSWFAAFUJYLHB-XZOQPEGZSA-N |
| XLogP | 4.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|