C17H20FN3OS — CID 90645009
4-fluoro-N-[(1R,2S)-2-(1,3-thiazol-2-ylmethylamino)cyclohexyl]benzamide (PubChem CID 90645009) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,2S)-2-(1,3-thiazol-2-ylmethylamino)cyclohexyl]benzamide.
| Compound Name | 4-fluoro-N-[(1R,2S)-2-(1,3-thiazol-2-ylmethylamino)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 90645009 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-fluoro-N-[(1R,2S)-2-(1,3-thiazol-2-ylmethylamino)cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1NCc1nccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3OS/c18-13-7-5-12(6-8-13)17(22)21-15-4-2-1-3-14(15)20-11-16-19-9-10-23-16/h5-10,14-15,20H,1-4,11H2,(H,21,22)/t14-,15+/m0/s1 |
| InChIKey | CWLAELWPWAVGPD-LSDHHAIUSA-N |
| XLogP | 3.11 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |