C34H42N4O6 — CID 90645056
N-[5-[[4-(diethylamino)phenyl]methyl]-4-[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 90645056) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is N-[5-[[4-(diethylamino)phenyl]methyl]-4-[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-[[4-(diethylamino)phenyl]methyl]-4-[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 90645056 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | N-[5-[[4-(diethylamino)phenyl]methyl]-4-[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)c1ccc(Cc2c(Cc3ccc(OC)c(OC)c3)nc(NC(=O)c3cc(OC)c(OC)c(OC)c3)n2C)cc1 |
| InChI | InChI=1S/C34H42N4O6/c1-9-38(10-2)25-14-11-22(12-15-25)18-27-26(17-23-13-16-28(40-4)29(19-23)41-5)35-34(37(27)3)36-33(39)24-20-30(42-6)32(44-8)31(21-24)43-7/h11-16,19-21H,9-10,17-18H2,1-8H3,(H,35,36,39) |
| InChIKey | BOQHMDZKZCCXDM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|