C18H19N5O3S — CID 90645134
5-phenyl-N-propan-2-yl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 90645134) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 5-phenyl-N-propan-2-yl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-phenyl-N-propan-2-yl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 90645134 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 5-phenyl-N-propan-2-yl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)NC(=O)c1nc(-c2ccccc2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C18H19N5O3S/c1-12(2)20-18(24)16-21-17(13-6-4-3-5-7-13)23(22-16)14-8-10-15(11-9-14)27(19,25)26/h3-12H,1-2H3,(H,20,24)(H2,19,25,26) |
| InChIKey | WVLNZLHPDNGOPV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |