C21H23N5O3S — CID 90645135
N-cyclohexyl-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 90645135) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-cyclohexyl-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-cyclohexyl-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 90645135 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-cyclohexyl-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(=O)NC3CCCCC3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N5O3S/c22-30(28,29)18-13-11-17(12-14-18)26-20(15-7-3-1-4-8-15)24-19(25-26)21(27)23-16-9-5-2-6-10-16/h1,3-4,7-8,11-14,16H,2,5-6,9-10H2,(H,23,27)(H2,22,28,29) |
| InChIKey | WLJBYZSHUFEDCX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |