C22H19N5O3S — CID 90645137
N-(4-methylphenyl)-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 90645137) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-(4-methylphenyl)-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-methylphenyl)-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 90645137 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-(4-methylphenyl)-5-phenyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nc(-c3ccccc3)n(-c3ccc(S(N)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C22H19N5O3S/c1-15-7-9-17(10-8-15)24-22(28)20-25-21(16-5-3-2-4-6-16)27(26-20)18-11-13-19(14-12-18)31(23,29)30/h2-14H,1H3,(H,24,28)(H2,23,29,30) |
| InChIKey | ZJZXSQPHUQUHIV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |