About 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine
4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 90645152) has the molecular formula C14H17IN6
and a molecular weight of 396.24 g/mol. Its IUPAC name is 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine |
| PubChem CID | 90645152 |
| Molecular Formula | C14H17IN6 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCN(c2nc(N)nc(-c3ccc(I)cc3)n2)CC1 |
| InChI | InChI=1S/C14H17IN6/c1-20-6-8-21(9-7-20)14-18-12(17-13(16)19-14)10-2-4-11(15)5-3-10/h2-5H,6-9H2,1H3,(H2,16,17,18,19) |
| InChIKey | AIOXPEONIJLZQJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine?
The IUPAC name of 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine (CID 90645152) is 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine?
The canonical SMILES for 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine is CN1CCN(c2nc(N)nc(-c3ccc(I)cc3)n2)CC1.
What is the InChIKey of 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine?
The InChIKey is AIOXPEONIJLZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17IN6/c1-20-6-8-21(9-7-20)14-18-12(17-13(16)19-14)10-2-4-11(15)5-3-10/h2-5H,6-9H2,1H3,(H2,16,17,18,19).
What are the key properties of 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine?
4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine has a molecular weight of 396.24 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-iodophenyl)-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 90645152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).