C14H15F3N6 — CID 90645162
4-(4-methylpiperazin-1-yl)-6-(3,4,5-trifluorophenyl)-1,3,5-triazin-2-amine (PubChem CID 90645162) has the molecular formula C14H15F3N6 and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-(3,4,5-trifluorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-(3,4,5-trifluorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90645162 |
| Molecular Formula | C14H15F3N6 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-(3,4,5-trifluorophenyl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCN(c2nc(N)nc(-c3cc(F)c(F)c(F)c3)n2)CC1 |
| InChI | InChI=1S/C14H15F3N6/c1-22-2-4-23(5-3-22)14-20-12(19-13(18)21-14)8-6-9(15)11(17)10(16)7-8/h6-7H,2-5H2,1H3,(H2,18,19,20,21) |
| InChIKey | ZVTDXJRLYVHFLH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|