C22H27Cl2N5O3 — CID 90645248
N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-[[(2R,4S)-2-(hydroxymethyl)oxan-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide (PubChem CID 90645248) has the molecular formula C22H27Cl2N5O3 and a molecular weight of 480.40 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-[[(2R,4S)-2-(hydroxymethyl)oxan-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-[[(2R,4S)-2-(hydroxymethyl)oxan-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 90645248 |
| Molecular Formula | C22H27Cl2N5O3 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-[[(2R,4S)-2-(hydroxymethyl)oxan-4-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCc2cnc(N[C@H]3CCO[C@@H](CO)C3)nc2C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H27Cl2N5O3/c1-13(14-2-3-18(23)19(24)8-14)26-22(31)29-6-4-15-10-25-21(28-20(15)11-29)27-16-5-7-32-17(9-16)12-30/h2-3,8,10,13,16-17,30H,4-7,9,11-12H2,1H3,(H,26,31)(H,25,27,28)/t13-,16+,17-/m1/s1 |
| InChIKey | TYQOIFDVJMCWNW-XOKHGSTOSA-N |
| XLogP | 3.56 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |