C26H35N5O2S — CID 90645290
3-amino-N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 90645290) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is 3-amino-N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90645290 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 3-amino-N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccccc1N1CCN(CCCCCNC(=O)c2sc3nc(C)cc(C)c3c2N)CC1 |
| InChI | InChI=1S/C26H35N5O2S/c1-18-17-19(2)29-26-22(18)23(27)24(34-26)25(32)28-11-7-4-8-12-30-13-15-31(16-14-30)20-9-5-6-10-21(20)33-3/h5-6,9-10,17H,4,7-8,11-16,27H2,1-3H3,(H,28,32) |
| InChIKey | KUBIIYUHICAQBT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|