About 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine
7-(2,4-difluorophenoxy)furo[2,3-c]pyridine (PubChem CID 90645318) has the molecular formula C13H7F2NO2
and a molecular weight of 247.20 g/mol. Its IUPAC name is 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine |
| PubChem CID | 90645318 |
| Molecular Formula | C13H7F2NO2 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine |
| SMILES | Fc1ccc(Oc2nccc3ccoc23)c(F)c1 |
| InChI | InChI=1S/C13H7F2NO2/c14-9-1-2-11(10(15)7-9)18-13-12-8(3-5-16-13)4-6-17-12/h1-7H |
| InChIKey | WHCSBGLJMIAOLK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine?
The IUPAC name of 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine (CID 90645318) is 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine.
What is the SMILES notation for 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine?
The canonical SMILES for 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine is Fc1ccc(Oc2nccc3ccoc23)c(F)c1.
What is the InChIKey of 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine?
The InChIKey is WHCSBGLJMIAOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2NO2/c14-9-1-2-11(10(15)7-9)18-13-12-8(3-5-16-13)4-6-17-12/h1-7H.
What are the key properties of 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine?
7-(2,4-difluorophenoxy)furo[2,3-c]pyridine has a molecular weight of 247.20 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,4-difluorophenoxy)furo[2,3-c]pyridine is sourced from PubChem (CID 90645318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).