About [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide
[(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide (PubChem CID 90645357) has the molecular formula C18H22IN3O2S
and a molecular weight of 471.36 g/mol. Its IUPAC name is [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide.
Molecular Properties
| Compound Name | [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide |
| PubChem CID | 90645357 |
| Molecular Formula | C18H22IN3O2S |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide |
| SMILES | C[N+]12CCC(CC1)[C@@H](OC(=O)Nc1ncsc1-c1ccccc1)C2.[I-] |
| InChI | InChI=1S/C18H21N3O2S.HI/c1-21-9-7-13(8-10-21)15(11-21)23-18(22)20-17-16(24-12-19-17)14-5-3-2-4-6-14;/h2-6,12-13,15H,7-11H2,1H3;1H/t13?,15-,21?;/m0./s1 |
| InChIKey | LQDXKSHAKSYRJH-YAMMMNJUSA-N |
| XLogP | 0.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide?
The IUPAC name of [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide (CID 90645357) is [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide.
What is the SMILES notation for [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide?
The canonical SMILES for [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide is C[N+]12CCC(CC1)[C@@H](OC(=O)Nc1ncsc1-c1ccccc1)C2.[I-].
What is the InChIKey of [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide?
The InChIKey is LQDXKSHAKSYRJH-YAMMMNJUSA-N. The full InChI is InChI=1S/C18H21N3O2S.HI/c1-21-9-7-13(8-10-21)15(11-21)23-18(22)20-17-16(24-12-19-17)14-5-3-2-4-6-14;/h2-6,12-13,15H,7-11H2,1H3;1H/t13?,15-,21?;/m0./s1.
What are the key properties of [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide?
[(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide has a molecular weight of 471.36 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate iodide is sourced from PubChem (CID 90645357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).